C20H25NO3 — CID 134526025
(1R,5R,6S)-11-methoxy-14-methyl-2-methylidene-6-(prop-2-enylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-ol (PubChem CID 134526025) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (1R,5R,6S)-11-methoxy-14-methyl-2-methylidene-6-(prop-2-enylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-ol.
| Compound Name | (1R,5R,6S)-11-methoxy-14-methyl-2-methylidene-6-(prop-2-enylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-ol |
|---|---|
| PubChem CID | 134526025 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (1R,5R,6S)-11-methoxy-14-methyl-2-methylidene-6-(prop-2-enylamino)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-5-ol |
| SMILES | C=CCN[C@H]1Cc2ccc(OC)c3c2C2(C)[C@H](O3)C(=C)CC[C@]12O |
| InChI | InChI=1S/C20H25NO3/c1-5-10-21-15-11-13-6-7-14(23-4)17-16(13)19(3)18(24-17)12(2)8-9-20(15,19)22/h5-7,15,18,21-22H,1-2,8-11H2,3-4H3/t15-,18+,19?,20-/m0/s1 |
| InChIKey | TVSOQQAYGUJFRU-NEHXDQOVSA-N |
| XLogP | 2.50 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|