C22H29NO3 — CID 139351509
(4S,4aR,7aR,12bR)-9-methoxy-4,12-dimethyl-7-methylidene-3-prop-2-enyl-1,2,4,5,6,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 139351509) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (4S,4aR,7aR,12bR)-9-methoxy-4,12-dimethyl-7-methylidene-3-prop-2-enyl-1,2,4,5,6,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4S,4aR,7aR,12bR)-9-methoxy-4,12-dimethyl-7-methylidene-3-prop-2-enyl-1,2,4,5,6,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 139351509 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4S,4aR,7aR,12bR)-9-methoxy-4,12-dimethyl-7-methylidene-3-prop-2-enyl-1,2,4,5,6,7a-hexahydro-[1]benzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | C=CCN1CC[C@@]23c4c(C)ccc(OC)c4O[C@@H]2C(=C)CC[C@]3(O)[C@@H]1C |
| InChI | InChI=1S/C22H29NO3/c1-6-12-23-13-11-21-18-14(2)7-8-17(25-5)19(18)26-20(21)15(3)9-10-22(21,24)16(23)4/h6-8,16,20,24H,1,3,9-13H2,2,4-5H3/t16-,20+,21+,22-/m0/s1 |
| InChIKey | DQBDDFIOHDRCPE-ZJQURUERSA-N |
| XLogP | 3.36 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|