C29H27NO5 — CID 91824408
(1R,2S,6R,14R)-11,15-dimethoxy-5-methyl-13-oxa-5-azaoctacyclo[13.10.2.12,8.01,6.02,14.016,25.018,23.012,28]octacosa-8(28),9,11,16,18,20,22,24,26-nonaene-17,24-diol (PubChem CID 91824408) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is (1R,2S,6R,14R)-11,15-dimethoxy-5-methyl-13-oxa-5-azaoctacyclo[13.10.2.12,8.01,6.02,14.016,25.018,23.012,28]octacosa-8(28),9,11,16,18,20,22,24,26-nonaene-17,24-diol.
| Compound Name | (1R,2S,6R,14R)-11,15-dimethoxy-5-methyl-13-oxa-5-azaoctacyclo[13.10.2.12,8.01,6.02,14.016,25.018,23.012,28]octacosa-8(28),9,11,16,18,20,22,24,26-nonaene-17,24-diol |
|---|---|
| PubChem CID | 91824408 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (1R,2S,6R,14R)-11,15-dimethoxy-5-methyl-13-oxa-5-azaoctacyclo[13.10.2.12,8.01,6.02,14.016,25.018,23.012,28]octacosa-8(28),9,11,16,18,20,22,24,26-nonaene-17,24-diol |
| SMILES | COc1ccc2c3c1O[C@H]1C4(OC)C=C[C@@]5(c6c4c(O)c4ccccc4c6O)[C@@H](C2)N(C)CC[C@]315 |
| InChI | InChI=1S/C29H27NO5/c1-30-13-12-28-20-15-8-9-18(33-2)25(20)35-26(28)29(34-3)11-10-27(28,19(30)14-15)21-22(29)24(32)17-7-5-4-6-16(17)23(21)31/h4-11,19,26,31-32H,12-14H2,1-3H3/t19-,26-,27+,28+,29?/m1/s1 |
| InChIKey | OKEAVKXCBCXNTC-STORXBFESA-N |
| XLogP | 3.88 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|