C25H27NO5 — CID 98474825
(1S,2S,6S,14S,15S)-11,15-dimethoxy-5-methyl-13-oxa-5-azaheptacyclo[13.6.2.12,8.01,6.02,14.016,21.012,24]tetracosa-8(24),9,11,16,18,20-hexaene-17,20-diol (PubChem CID 98474825) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is (1S,2S,6S,14S,15S)-11,15-dimethoxy-5-methyl-13-oxa-5-azaheptacyclo[13.6.2.12,8.01,6.02,14.016,21.012,24]tetracosa-8(24),9,11,16,18,20-hexaene-17,20-diol.
| Compound Name | (1S,2S,6S,14S,15S)-11,15-dimethoxy-5-methyl-13-oxa-5-azaheptacyclo[13.6.2.12,8.01,6.02,14.016,21.012,24]tetracosa-8(24),9,11,16,18,20-hexaene-17,20-diol |
|---|---|
| PubChem CID | 98474825 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (1S,2S,6S,14S,15S)-11,15-dimethoxy-5-methyl-13-oxa-5-azaheptacyclo[13.6.2.12,8.01,6.02,14.016,21.012,24]tetracosa-8(24),9,11,16,18,20-hexaene-17,20-diol |
| SMILES | COc1ccc2c3c1O[C@@H]1[C@]4(OC)CC[C@]5(c6c(O)ccc(O)c64)[C@H](C2)N(C)CC[C@]315 |
| InChI | InChI=1S/C25H27NO5/c1-26-11-10-24-18-13-4-7-16(29-2)21(18)31-22(24)25(30-3)9-8-23(24,17(26)12-13)19-14(27)5-6-15(28)20(19)25/h4-7,17,22,27-28H,8-12H2,1-3H3/t17-,22-,23+,24-,25-/m0/s1 |
| InChIKey | YZNGNRIKFYLUTN-JVIOVZNBSA-N |
| XLogP | 2.95 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|