C26H29NO5S — CID 59868666
(1R)-4,12-dimethoxy-3-methyl-17-(4-methylphenyl)sulfonyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one (PubChem CID 59868666) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is (1R)-4,12-dimethoxy-3-methyl-17-(4-methylphenyl)sulfonyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one.
| Compound Name | (1R)-4,12-dimethoxy-3-methyl-17-(4-methylphenyl)sulfonyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
|---|---|
| PubChem CID | 59868666 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | (1R)-4,12-dimethoxy-3-methyl-17-(4-methylphenyl)sulfonyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5,11-tetraen-13-one |
| SMILES | COC1=CC2C3Cc4ccc(OC)c(C)c4[C@]2(CCN3S(=O)(=O)c2ccc(C)cc2)CC1=O |
| InChI | InChI=1S/C26H29NO5S/c1-16-5-8-19(9-6-16)33(29,30)27-12-11-26-15-22(28)24(32-4)14-20(26)21(27)13-18-7-10-23(31-3)17(2)25(18)26/h5-10,14,20-21H,11-13,15H2,1-4H3/t20?,21?,26-/m1/s1 |
| InChIKey | YTYIMUMEOPYBST-VGMBQNGWSA-N |
| XLogP | 3.69 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |