C16H20NO+ — CID 163185801
(1S,9R,10R)-17-hydroxy-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene (PubChem CID 163185801) has the molecular formula C16H20NO+ and a molecular weight of 242.34 g/mol. Its IUPAC name is (1S,9R,10R)-17-hydroxy-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene.
| Compound Name | (1S,9R,10R)-17-hydroxy-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene |
|---|---|
| PubChem CID | 163185801 |
| Molecular Formula | C16H20NO+ |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (1S,9R,10R)-17-hydroxy-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6,13-tetraene |
| SMILES | O[NH+]1CC[C@]23C=CCC[C@H]2[C@H]1Cc1ccccc13 |
| InChI | InChI=1S/C16H19NO/c18-17-10-9-16-8-4-3-7-14(16)15(17)11-12-5-1-2-6-13(12)16/h1-2,4-6,8,14-15,18H,3,7,9-11H2/p+1/t14-,15+,16-/m0/s1 |
| InChIKey | RCXNOOIFLKUNGE-XHSDSOJGSA-O |
| XLogP | 1.49 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|