C27H30O9 — CID 59057735
[(2R,3R,4S,5R,6S)-4,5-diformyloxy-2-methyl-6-[[(1S,5R,13R,14S)-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-yl]oxy]oxan-3-yl] formate (PubChem CID 59057735) has the molecular formula C27H30O9 and a molecular weight of 498.53 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diformyloxy-2-methyl-6-[[(1S,5R,13R,14S)-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-yl]oxy]oxan-3-yl] formate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diformyloxy-2-methyl-6-[[(1S,5R,13R,14S)-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-yl]oxy]oxan-3-yl] formate |
|---|---|
| PubChem CID | 59057735 |
| Molecular Formula | C27H30O9 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diformyloxy-2-methyl-6-[[(1S,5R,13R,14S)-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraen-14-yl]oxy]oxan-3-yl] formate |
| SMILES | Cc1ccc2c3c1O[C@H]1[C@@H](O[C@@H]4O[C@H](C)[C@@H](OC=O)[C@H](OC=O)[C@H]4OC=O)C=CC4[C@H](CCC[C@@]341)C2 |
| InChI | InChI=1S/C27H30O9/c1-14-5-6-17-10-16-4-3-9-27-18(16)7-8-19(25(27)36-21(14)20(17)27)35-26-24(33-13-30)23(32-12-29)22(31-11-28)15(2)34-26/h5-8,11-13,15-16,18-19,22-26H,3-4,9-10H2,1-2H3/t15-,16-,18?,19+,22-,23+,24-,25+,26+,27+/m1/s1 |
| InChIKey | ISHHFLANQSTFJF-QACVTURCSA-N |
| XLogP | 2.29 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|