C19H23NO3 — CID 11905166
(1R,5S,13R,14S,17R)-10,14-dimethoxy-3-methyl-12-oxa-3-azapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraene (PubChem CID 11905166) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (1R,5S,13R,14S,17R)-10,14-dimethoxy-3-methyl-12-oxa-3-azapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraene.
| Compound Name | (1R,5S,13R,14S,17R)-10,14-dimethoxy-3-methyl-12-oxa-3-azapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraene |
|---|---|
| PubChem CID | 11905166 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (1R,5S,13R,14S,17R)-10,14-dimethoxy-3-methyl-12-oxa-3-azapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,15-tetraene |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@H](OC)C=C[C@@H]4[C@H](C2)CN(C)C[C@]341 |
| InChI | InChI=1S/C19H23NO3/c1-20-9-12-8-11-4-6-14(21-2)17-16(11)19(10-20)13(12)5-7-15(22-3)18(19)23-17/h4-7,12-13,15,18H,8-10H2,1-3H3/t12-,13-,15+,18+,19-/m1/s1 |
| InChIKey | LBCYQXWSCYRPMU-VULJSJLBSA-N |
| XLogP | 2.01 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|