C20H23NO3S2 — CID 14084042
O-[(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] methylsulfanylmethanethioate (PubChem CID 14084042) has the molecular formula C20H23NO3S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is O-[(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 14084042 |
| Molecular Formula | C20H23NO3S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | O-[(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] methylsulfanylmethanethioate |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@H](OC(=S)SC)C=C[C@H]4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C20H23NO3S2/c1-21-9-8-20-12-5-7-15(23-19(25)26-3)18(20)24-17-14(22-2)6-4-11(16(17)20)10-13(12)21/h4-7,12-13,15,18H,8-10H2,1-3H3/t12-,13+,15-,18-,20-/m0/s1 |
| InChIKey | MCWGKRWKPOIVCA-HZLQQORQSA-N |
| XLogP | 3.17 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|