C20H26NO6P — CID 69025796
[(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] ethyl hydrogen phosphate (PubChem CID 69025796) has the molecular formula C20H26NO6P and a molecular weight of 407.40 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] ethyl hydrogen phosphate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 69025796 |
| Molecular Formula | C20H26NO6P |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)O[C@H]1C=C[C@H]2[C@H]3Cc4ccc(OC)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C20H26NO6P/c1-4-25-28(22,23)27-16-8-6-13-14-11-12-5-7-15(24-3)18-17(12)20(13,19(16)26-18)9-10-21(14)2/h5-8,13-14,16,19H,4,9-11H2,1-3H3,(H,22,23)/t13-,14+,16-,19-,20-/m0/s1 |
| InChIKey | WMLIKVOWXKZDDU-BKRJIHRRSA-N |
| XLogP | 2.66 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|