C30H34NO6P — CID 58206292
2-(1,4-dihydronaphthalen-2-yl)ethyl (9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) hydrogen phosphate (PubChem CID 58206292) has the molecular formula C30H34NO6P and a molecular weight of 535.58 g/mol. Its IUPAC name is 2-(1,4-dihydronaphthalen-2-yl)ethyl (9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) hydrogen phosphate.
| Compound Name | 2-(1,4-dihydronaphthalen-2-yl)ethyl (9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) hydrogen phosphate |
|---|---|
| PubChem CID | 58206292 |
| Molecular Formula | C30H34NO6P |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 2-(1,4-dihydronaphthalen-2-yl)ethyl (9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) hydrogen phosphate |
| SMILES | COc1ccc2c3c1OC1C(OP(=O)(O)OCCC4=CCc5ccccc5C4)C=CC4C(C2)N(C)CCC341 |
| InChI | InChI=1S/C30H34NO6P/c1-31-15-14-30-23-10-12-26(29(30)36-28-25(34-2)11-9-22(27(28)30)18-24(23)31)37-38(32,33)35-16-13-19-7-8-20-5-3-4-6-21(20)17-19/h3-7,9-12,23-24,26,29H,8,13-18H2,1-2H3,(H,32,33) |
| InChIKey | ULDAIKNFSRAWGY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|