C18H20NO2+ — CID 91206875
9-methyl-3-methylidene-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-ol (PubChem CID 91206875) has the molecular formula C18H20NO2+ and a molecular weight of 282.36 g/mol. Its IUPAC name is 9-methyl-3-methylidene-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-ol.
| Compound Name | 9-methyl-3-methylidene-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-ol |
|---|---|
| PubChem CID | 91206875 |
| Molecular Formula | C18H20NO2+ |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 9-methyl-3-methylidene-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-ol |
| SMILES | C=[N+]1CCC23c4c5ccc(C)c4OC2C(O)C=CC3C1C5 |
| InChI | InChI=1S/C18H20NO2/c1-10-3-4-11-9-13-12-5-6-14(20)17-18(12,7-8-19(13)2)15(11)16(10)21-17/h3-6,12-14,17,20H,2,7-9H2,1H3/q+1 |
| InChIKey | ZRFKSHHVNOAINJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|