C18H18O2 — CID 170370377
(1S,5R,13R)-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,16-tetraen-14-one (PubChem CID 170370377) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1S,5R,13R)-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,16-tetraen-14-one.
| Compound Name | (1S,5R,13R)-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,16-tetraen-14-one |
|---|---|
| PubChem CID | 170370377 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (1S,5R,13R)-10-methyl-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,16-tetraen-14-one |
| SMILES | Cc1ccc2c3c1O[C@H]1C(=O)CC=C4[C@H](CCC[C@]431)C2 |
| InChI | InChI=1S/C18H18O2/c1-10-4-5-12-9-11-3-2-8-18-13(11)6-7-14(19)17(18)20-16(10)15(12)18/h4-6,11,17H,2-3,7-9H2,1H3/t11-,17+,18+/m1/s1 |
| InChIKey | VVYUOFJNHMHOGM-VQTKTOELSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|