C18H19NO3 — CID 70957348
(1S,5R,13S,19R)-8-methyl-6,18-dioxa-16-azahexacyclo[9.7.2.01,13.05,13.07,12.016,19]icosa-7,9,11-trien-4-one (PubChem CID 70957348) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (1S,5R,13S,19R)-8-methyl-6,18-dioxa-16-azahexacyclo[9.7.2.01,13.05,13.07,12.016,19]icosa-7,9,11-trien-4-one.
| Compound Name | (1S,5R,13S,19R)-8-methyl-6,18-dioxa-16-azahexacyclo[9.7.2.01,13.05,13.07,12.016,19]icosa-7,9,11-trien-4-one |
|---|---|
| PubChem CID | 70957348 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (1S,5R,13S,19R)-8-methyl-6,18-dioxa-16-azahexacyclo[9.7.2.01,13.05,13.07,12.016,19]icosa-7,9,11-trien-4-one |
| SMILES | Cc1ccc2c3c1O[C@H]1C(=O)CC[C@]45OCN(CC[C@]314)[C@@H]5C2 |
| InChI | InChI=1S/C18H19NO3/c1-10-2-3-11-8-13-18-5-4-12(20)16-17(18,14(11)15(10)22-16)6-7-19(13)9-21-18/h2-3,13,16H,4-9H2,1H3/t13-,16+,17+,18-/m1/s1 |
| InChIKey | VPVSDMIONPEQOZ-XFKAJCMBSA-N |
| XLogP | 1.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |