C24H25NO2 — CID 161270394
(4S,4aS)-3-benzyl-9-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 161270394) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (4S,4aS)-3-benzyl-9-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4S,4aS)-3-benzyl-9-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 161270394 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (4S,4aS)-3-benzyl-9-methyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | Cc1ccc2c3c1OC1C(=O)CC[C@@H]4[C@H](C2)N(Cc2ccccc2)CCC314 |
| InChI | InChI=1S/C24H25NO2/c1-15-7-8-17-13-19-18-9-10-20(26)23-24(18,21(17)22(15)27-23)11-12-25(19)14-16-5-3-2-4-6-16/h2-8,18-19,23H,9-14H2,1H3/t18-,19+,23?,24?/m1/s1 |
| InChIKey | VDSSEFAHITVHAJ-AQUVGYMESA-N |
| XLogP | 3.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |