C17H16O3 — CID 155121544
(1S,5R,13R)-10-hydroxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,16-tetraen-14-one (PubChem CID 155121544) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1S,5R,13R)-10-hydroxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,16-tetraen-14-one.
| Compound Name | (1S,5R,13R)-10-hydroxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,16-tetraen-14-one |
|---|---|
| PubChem CID | 155121544 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (1S,5R,13R)-10-hydroxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10,16-tetraen-14-one |
| SMILES | O=C1CC=C2[C@@H]3CCC[C@@]24c2c(ccc(O)c2O[C@@H]14)C3 |
| InChI | InChI=1S/C17H16O3/c18-12-5-3-10-8-9-2-1-7-17-11(9)4-6-13(19)16(17)20-15(12)14(10)17/h3-5,9,16,18H,1-2,6-8H2/t9-,16+,17+/m1/s1 |
| InChIKey | IIGVABWQTLKHAV-RSKJOKDDSA-N |
| XLogP | 2.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|