C19H19NO3 — CID 138713942
(4S,17S)-12-methoxy-3-methyl-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-5,11,13,15-tetraen-8-one (PubChem CID 138713942) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (4S,17S)-12-methoxy-3-methyl-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-5,11,13,15-tetraen-8-one.
| Compound Name | (4S,17S)-12-methoxy-3-methyl-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-5,11,13,15-tetraen-8-one |
|---|---|
| PubChem CID | 138713942 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (4S,17S)-12-methoxy-3-methyl-10-oxa-3-azahexacyclo[13.3.1.01,4.05,17.09,17.011,16]nonadeca-5,11,13,15-tetraen-8-one |
| SMILES | COc1ccc2c3c1OC1C(=O)CC=C4[C@@H]5N(C)CC5(C2)C[C@]431 |
| InChI | InChI=1S/C19H19NO3/c1-20-9-18-7-10-3-6-13(22-2)15-14(10)19(8-18)11(16(18)20)4-5-12(21)17(19)23-15/h3-4,6,16-17H,5,7-9H2,1-2H3/t16-,17?,18?,19-/m0/s1 |
| InChIKey | BIKYUWYTSNJSGQ-RGVPCPSESA-N |
| XLogP | 1.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|