C18H21NO4 — CID 10041391
(1S,4R,12S)-7-methoxy-15-methyl-5,16-dioxa-15-azapentacyclo[8.7.2.01,12.04,12.06,11]nonadeca-6,8,10-trien-3-one (PubChem CID 10041391) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is (1S,4R,12S)-7-methoxy-15-methyl-5,16-dioxa-15-azapentacyclo[8.7.2.01,12.04,12.06,11]nonadeca-6,8,10-trien-3-one.
| Compound Name | (1S,4R,12S)-7-methoxy-15-methyl-5,16-dioxa-15-azapentacyclo[8.7.2.01,12.04,12.06,11]nonadeca-6,8,10-trien-3-one |
|---|---|
| PubChem CID | 10041391 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (1S,4R,12S)-7-methoxy-15-methyl-5,16-dioxa-15-azapentacyclo[8.7.2.01,12.04,12.06,11]nonadeca-6,8,10-trien-3-one |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)C[C@]4(CC2)CON(C)CC[C@]314 |
| InChI | InChI=1S/C18H21NO4/c1-19-8-7-18-14-11-3-4-13(21-2)15(14)23-16(18)12(20)9-17(18,6-5-11)10-22-19/h3-4,16H,5-10H2,1-2H3/t16-,17+,18-/m0/s1 |
| InChIKey | UKLMSFCHPWJCAR-KSZLIROESA-N |
| XLogP | 1.87 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |