C31H25NO5 — CID 166880712
[(4S,7aS,12bR)-3-benzoyl-7-methoxy-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] benzoate (PubChem CID 166880712) has the molecular formula C31H25NO5 and a molecular weight of 491.54 g/mol. Its IUPAC name is [(4S,7aS,12bR)-3-benzoyl-7-methoxy-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] benzoate.
| Compound Name | [(4S,7aS,12bR)-3-benzoyl-7-methoxy-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] benzoate |
|---|---|
| PubChem CID | 166880712 |
| Molecular Formula | C31H25NO5 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | [(4S,7aS,12bR)-3-benzoyl-7-methoxy-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] benzoate |
| SMILES | COC1=CC=C2[C@@H]3Cc4ccc(OC(=O)c5ccccc5)c5c4[C@]2(CCN3C(=O)c2ccccc2)[C@@H]1O5 |
| InChI | InChI=1S/C31H25NO5/c1-35-25-15-13-22-23-18-21-12-14-24(36-30(34)20-10-6-3-7-11-20)27-26(21)31(22,28(25)37-27)16-17-32(23)29(33)19-8-4-2-5-9-19/h2-15,23,28H,16-18H2,1H3/t23-,28+,31+/m0/s1 |
| InChIKey | XZMYRYHSJBDYEX-GFDPGFINSA-N |
| XLogP | 4.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|