C21H29NO2 — CID 145410413
(7aR)-7-methoxy-3,4,12-trimethyl-1,2,4,7a-tetrahydro-[1]benzofuro[3,2-e]isoquinoline;ethane (PubChem CID 145410413) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (7aR)-7-methoxy-3,4,12-trimethyl-1,2,4,7a-tetrahydro-[1]benzofuro[3,2-e]isoquinoline;ethane.
| Compound Name | (7aR)-7-methoxy-3,4,12-trimethyl-1,2,4,7a-tetrahydro-[1]benzofuro[3,2-e]isoquinoline;ethane |
|---|---|
| PubChem CID | 145410413 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (7aR)-7-methoxy-3,4,12-trimethyl-1,2,4,7a-tetrahydro-[1]benzofuro[3,2-e]isoquinoline;ethane |
| SMILES | CC.COC1=CC=C2C(C)N(C)CCC23c2c(C)cccc2O[C@@H]13 |
| InChI | InChI=1S/C19H23NO2.C2H6/c1-12-6-5-7-15-17(12)19-10-11-20(3)13(2)14(19)8-9-16(21-4)18(19)22-15;1-2/h5-9,13,18H,10-11H2,1-4H3;1-2H3/t13?,18-,19?;/m0./s1 |
| InChIKey | JYKDFKMYZJMIBO-FROSDXGQSA-N |
| XLogP | 4.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |