C23H30BrNO4 — CID 143822058
ethane;methyl (7aS,12bR)-11-bromo-9-methoxy-3,4,12-trimethyl-1,2,4,7a-tetrahydro-[1]benzofuro[3,2-e]isoquinoline-7-carboxylate (PubChem CID 143822058) has the molecular formula C23H30BrNO4 and a molecular weight of 464.40 g/mol. Its IUPAC name is ethane;methyl (7aS,12bR)-11-bromo-9-methoxy-3,4,12-trimethyl-1,2,4,7a-tetrahydro-[1]benzofuro[3,2-e]isoquinoline-7-carboxylate.
| Compound Name | ethane;methyl (7aS,12bR)-11-bromo-9-methoxy-3,4,12-trimethyl-1,2,4,7a-tetrahydro-[1]benzofuro[3,2-e]isoquinoline-7-carboxylate |
|---|---|
| PubChem CID | 143822058 |
| Molecular Formula | C23H30BrNO4 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | ethane;methyl (7aS,12bR)-11-bromo-9-methoxy-3,4,12-trimethyl-1,2,4,7a-tetrahydro-[1]benzofuro[3,2-e]isoquinoline-7-carboxylate |
| SMILES | CC.COC(=O)C1=CC=C2C(C)N(C)CC[C@]23c2c(C)c(Br)cc(OC)c2O[C@H]13 |
| InChI | InChI=1S/C21H24BrNO4.C2H6/c1-11-15(22)10-16(25-4)18-17(11)21-8-9-23(3)12(2)14(21)7-6-13(19(21)27-18)20(24)26-5;1-2/h6-7,10,12,19H,8-9H2,1-5H3;1-2H3/t12?,19-,21-;/m1./s1 |
| InChIKey | VVWIRYFEPMJBQJ-XQGRHCNBSA-N |
| XLogP | 4.55 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |