C25H31NO4 — CID 118983522
cyclopropyl-[(2S,6R,14R,15R,16R)-11,15-dimethoxy-16-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-5-yl]methanone (PubChem CID 118983522) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is cyclopropyl-[(2S,6R,14R,15R,16R)-11,15-dimethoxy-16-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-5-yl]methanone.
| Compound Name | cyclopropyl-[(2S,6R,14R,15R,16R)-11,15-dimethoxy-16-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-5-yl]methanone |
|---|---|
| PubChem CID | 118983522 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | cyclopropyl-[(2S,6R,14R,15R,16R)-11,15-dimethoxy-16-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-5-yl]methanone |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@]4(OC)CCC5(C[C@H]4C)[C@@H](C2)N(C(=O)C2CC2)CC[C@]315 |
| InChI | InChI=1S/C25H31NO4/c1-14-13-23-8-9-25(14,29-3)22-24(23)10-11-26(21(27)15-4-5-15)18(23)12-16-6-7-17(28-2)20(30-22)19(16)24/h6-7,14-15,18,22H,4-5,8-13H2,1-3H3/t14-,18-,22-,23?,24+,25-/m1/s1 |
| InChIKey | GQCNTPZQCUWQJW-CZJJMEPCSA-N |
| XLogP | 3.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |