C36H45N3O4 — CID 155540770
1-[4-[4-[(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]phenyl]piperazin-1-yl]ethanone (PubChem CID 155540770) has the molecular formula C36H45N3O4 and a molecular weight of 583.77 g/mol. Its IUPAC name is 1-[4-[4-[(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 155540770 |
| Molecular Formula | C36H45N3O4 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.34 |
| IUPAC Name | 1-[4-[4-[(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]phenyl]piperazin-1-yl]ethanone |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@]4(OC)CC[C@@]5(C[C@@H]4c4ccc(N6CCN(C(C)=O)CC6)cc4)[C@@H](C2)N(CC2CC2)CC[C@]315 |
| InChI | InChI=1S/C36H45N3O4/c1-23(40)37-16-18-38(19-17-37)27-9-6-25(7-10-27)28-21-34-12-13-36(28,42-3)33-35(34)14-15-39(22-24-4-5-24)30(34)20-26-8-11-29(41-2)32(43-33)31(26)35/h6-11,24,28,30,33H,4-5,12-22H2,1-3H3/t28-,30-,33-,34-,35+,36-/m1/s1 |
| InChIKey | WLYCVORMFCAGGZ-QTDSEMIKSA-N |
| XLogP | 4.76 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|