C39H44N2O5 — CID 164619130
[4-[[3-[(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]anilino]methyl]phenyl] acetate (PubChem CID 164619130) has the molecular formula C39H44N2O5 and a molecular weight of 620.79 g/mol. Its IUPAC name is [4-[[3-[(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]anilino]methyl]phenyl] acetate.
| Compound Name | [4-[[3-[(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]anilino]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 164619130 |
| Molecular Formula | C39H44N2O5 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | [4-[[3-[(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-16-yl]anilino]methyl]phenyl] acetate |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@]4(OC)CC[C@@]5(C[C@@H]4c4cccc(NCc6ccc(OC(C)=O)cc6)c4)[C@@H](C2)N(CC2CC2)CC[C@]315 |
| InChI | InChI=1S/C39H44N2O5/c1-24(42)45-30-12-9-25(10-13-30)22-40-29-6-4-5-27(19-29)31-21-37-15-16-39(31,44-3)36-38(37)17-18-41(23-26-7-8-26)33(37)20-28-11-14-32(43-2)35(46-36)34(28)38/h4-6,9-14,19,26,31,33,36,40H,7-8,15-18,20-23H2,1-3H3/t31-,33-,36-,37-,38+,39-/m1/s1 |
| InChIKey | JOEJTTSUQWUTQC-SCYFHADWSA-N |
| XLogP | 6.62 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|