C22H24N2O4 — CID 58049333
(4'R,12'bS)-9'-isocyano-3'-prop-2-enylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol (PubChem CID 58049333) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (4'R,12'bS)-9'-isocyano-3'-prop-2-enylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol.
| Compound Name | (4'R,12'bS)-9'-isocyano-3'-prop-2-enylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol |
|---|---|
| PubChem CID | 58049333 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (4'R,12'bS)-9'-isocyano-3'-prop-2-enylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol |
| SMILES | [C-]#[N+]c1ccc2c3c1OC1C4(CCC5(O)[C@@H](C2)N(CC=C)CC[C@]315)OCCO4 |
| InChI | InChI=1S/C22H24N2O4/c1-3-9-24-10-8-20-17-14-4-5-15(23-2)18(17)28-19(20)22(26-11-12-27-22)7-6-21(20,25)16(24)13-14/h3-5,16,19,25H,1,6-13H2/t16-,19?,20+,21?/m1/s1 |
| InChIKey | PHRYRDVKRLEMPT-ZEXAPNKDSA-N |
| XLogP | 2.32 |
| TPSA | 55.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|