C29H33NO5 — CID 102211875
(1R,2R,6R,14R,15R,19R)-11,15-dimethoxy-5-methyl-19-(phenylmethoxymethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-17-one (PubChem CID 102211875) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is (1R,2R,6R,14R,15R,19R)-11,15-dimethoxy-5-methyl-19-(phenylmethoxymethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-17-one.
| Compound Name | (1R,2R,6R,14R,15R,19R)-11,15-dimethoxy-5-methyl-19-(phenylmethoxymethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-17-one |
|---|---|
| PubChem CID | 102211875 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (1R,2R,6R,14R,15R,19R)-11,15-dimethoxy-5-methyl-19-(phenylmethoxymethyl)-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-17-one |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@]4(OC)CC(=O)[C@@]5(C[C@@H]4COCc4ccccc4)[C@@H](C2)N(C)CC[C@]315 |
| InChI | InChI=1S/C29H33NO5/c1-30-12-11-27-24-19-9-10-21(32-2)25(24)35-26(27)29(33-3)15-23(31)28(27,22(30)13-19)14-20(29)17-34-16-18-7-5-4-6-8-18/h4-10,20,22,26H,11-17H2,1-3H3/t20-,22-,26-,27+,28-,29-/m1/s1 |
| InChIKey | ILKHWOWLCAZVOZ-VLDFEUPUSA-N |
| XLogP | 3.54 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |