C29H38N2O5 — CID 56949308
(6R,14R,16R)-11,15-dimethoxy-5-methyl-16-[(3-propyl-1,2-oxazol-5-yl)methoxymethyl]-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene (PubChem CID 56949308) has the molecular formula C29H38N2O5 and a molecular weight of 494.63 g/mol. Its IUPAC name is (6R,14R,16R)-11,15-dimethoxy-5-methyl-16-[(3-propyl-1,2-oxazol-5-yl)methoxymethyl]-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene.
| Compound Name | (6R,14R,16R)-11,15-dimethoxy-5-methyl-16-[(3-propyl-1,2-oxazol-5-yl)methoxymethyl]-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene |
|---|---|
| PubChem CID | 56949308 |
| Molecular Formula | C29H38N2O5 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | (6R,14R,16R)-11,15-dimethoxy-5-methyl-16-[(3-propyl-1,2-oxazol-5-yl)methoxymethyl]-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene |
| SMILES | CCCc1cc(COC[C@H]2CC34CCC2(OC)[C@@H]2Oc5c(OC)ccc6c5C23CCN(C)[C@@H]4C6)on1 |
| InChI | InChI=1S/C29H38N2O5/c1-5-6-20-14-21(36-30-20)17-34-16-19-15-27-9-10-29(19,33-4)26-28(27)11-12-31(2)23(27)13-18-7-8-22(32-3)25(35-26)24(18)28/h7-8,14,19,23,26H,5-6,9-13,15-17H2,1-4H3/t19-,23-,26-,27?,28?,29?/m1/s1 |
| InChIKey | VGPKXDDDJZDRDW-AEOHMSLLSA-N |
| XLogP | 4.30 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |