C22H32N2O3 — CID 118972704
2-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethylamino]acetic acid (PubChem CID 118972704) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethylamino]acetic acid.
| Compound Name | 2-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethylamino]acetic acid |
|---|---|
| PubChem CID | 118972704 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 2-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethylamino]acetic acid |
| SMILES | COc1ccc2c(c1)[C@]1(CCNCC(=O)O)CCN(CC3CC3)[C@H](C2)[C@@H]1C |
| InChI | InChI=1S/C22H32N2O3/c1-15-20-11-17-5-6-18(27-2)12-19(17)22(15,7-9-23-13-21(25)26)8-10-24(20)14-16-3-4-16/h5-6,12,15-16,20,23H,3-4,7-11,13-14H2,1-2H3,(H,25,26)/t15-,20+,22+/m0/s1 |
| InChIKey | RUYBDGIWFHRVNM-ZAOYMGCJSA-N |
| XLogP | 2.67 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|