C22H33N3O2 — CID 131985508
2-amino-N-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethyl]acetamide (PubChem CID 131985508) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-amino-N-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethyl]acetamide.
| Compound Name | 2-amino-N-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 131985508 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 2-amino-N-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethyl]acetamide |
| SMILES | COc1ccc2c(c1)[C@]1(CCNC(=O)CN)CCN(CC3CC3)[C@H](C2)[C@@H]1C |
| InChI | InChI=1S/C22H33N3O2/c1-15-20-11-17-5-6-18(27-2)12-19(17)22(15,7-9-24-21(26)13-23)8-10-25(20)14-16-3-4-16/h5-6,12,15-16,20H,3-4,7-11,13-14,23H2,1-2H3,(H,24,26)/t15-,20+,22+/m0/s1 |
| InChIKey | CXELPTGPBOXGDA-ZAOYMGCJSA-N |
| XLogP | 2.07 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |