C28H36N2O2 — CID 158316968
N-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-hydroxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethyl]-3-phenylpropanamide (PubChem CID 158316968) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-hydroxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethyl]-3-phenylpropanamide.
| Compound Name | N-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-hydroxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 158316968 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | N-[2-[(1R,9R,13R)-10-(cyclopropylmethyl)-4-hydroxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]ethyl]-3-phenylpropanamide |
| SMILES | C[C@H]1[C@H]2Cc3ccc(O)cc3[C@]1(CCNC(=O)CCc1ccccc1)CCN2CC1CC1 |
| InChI | InChI=1S/C28H36N2O2/c1-20-26-17-23-10-11-24(31)18-25(23)28(20,14-16-30(26)19-22-7-8-22)13-15-29-27(32)12-9-21-5-3-2-4-6-21/h2-6,10-11,18,20,22,26,31H,7-9,12-17,19H2,1H3,(H,29,32)/t20-,26+,28+/m0/s1 |
| InChIKey | GOJKOJHKYLQQDO-TUDQOENJSA-N |
| XLogP | 4.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |