C24H37NO3 — CID 90050524
(1R,9R,13R)-10-(cyclopropylmethyl)-1-(4,4-dimethoxybutyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene (PubChem CID 90050524) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is (1R,9R,13R)-10-(cyclopropylmethyl)-1-(4,4-dimethoxybutyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene.
| Compound Name | (1R,9R,13R)-10-(cyclopropylmethyl)-1-(4,4-dimethoxybutyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 90050524 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | (1R,9R,13R)-10-(cyclopropylmethyl)-1-(4,4-dimethoxybutyl)-4-methoxy-13-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@]1(CCCC(OC)OC)CCN(CC3CC3)[C@H](C2)[C@@H]1C |
| InChI | InChI=1S/C24H37NO3/c1-17-22-14-19-9-10-20(26-2)15-21(19)24(17,11-5-6-23(27-3)28-4)12-13-25(22)16-18-7-8-18/h9-10,15,17-18,22-23H,5-8,11-14,16H2,1-4H3/t17-,22+,24+/m0/s1 |
| InChIKey | WTNSXCOMEZDRTR-VXWZWFMZSA-N |
| XLogP | 4.40 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|