C22H25NO2 — CID 146390026
[(1S,9S,15S)-10-methyl-10-azapentacyclo[7.5.1.11,11.02,7.011,15]hexadeca-2(7),3,5-trien-4-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 146390026) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is [(1S,9S,15S)-10-methyl-10-azapentacyclo[7.5.1.11,11.02,7.011,15]hexadeca-2(7),3,5-trien-4-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(1S,9S,15S)-10-methyl-10-azapentacyclo[7.5.1.11,11.02,7.011,15]hexadeca-2(7),3,5-trien-4-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 146390026 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | [(1S,9S,15S)-10-methyl-10-azapentacyclo[7.5.1.11,11.02,7.011,15]hexadeca-2(7),3,5-trien-4-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)Oc1ccc2c(c1)[C@@]13CCCC4(C1)[C@@H]3[C@H](C2)N4C |
| InChI | InChI=1S/C22H25NO2/c1-3-4-5-7-19(24)25-16-9-8-15-12-18-20-21(17(15)13-16)10-6-11-22(20,14-21)23(18)2/h3-5,7-9,13,18,20H,6,10-12,14H2,1-2H3/b4-3+,7-5+/t18-,20+,21+,22?/m0/s1 |
| InChIKey | HEFCFPBEFHWHAF-VIVSSNFRSA-N |
| XLogP | 3.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|