C25H31NO5 — CID 164616163
[(1R,9S,10S,12R)-4,12-dimethoxy-17-methyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 164616163) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is [(1R,9S,10S,12R)-4,12-dimethoxy-17-methyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(1R,9S,10S,12R)-4,12-dimethoxy-17-methyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 164616163 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | [(1R,9S,10S,12R)-4,12-dimethoxy-17-methyl-13-oxo-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-3-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)Oc1c(OC)ccc2c1[C@@]13CCN(C)[C@@H](C2)[C@H]1C[C@@H](OC)C(=O)C3 |
| InChI | InChI=1S/C25H31NO5/c1-5-6-7-8-22(28)31-24-20(29-3)10-9-16-13-18-17-14-21(30-4)19(27)15-25(17,23(16)24)11-12-26(18)2/h5-10,17-18,21H,11-15H2,1-4H3/b6-5+,8-7+/t17-,18+,21-,25-/m1/s1 |
| InChIKey | AWBFDQVSXCLBBC-JTTNCSEESA-N |
| XLogP | 3.22 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|