C24H27NO4 — CID 166897422
[(1R,6R,14S,15R)-14-ethyl-2-methyl-5-oxo-7-oxa-2-azapentacyclo[10.3.1.03,15.06,14.08,13]hexadeca-8,10,12-trien-9-yl] (2E)-5-methylhexa-2,4-dienoate (PubChem CID 166897422) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is [(1R,6R,14S,15R)-14-ethyl-2-methyl-5-oxo-7-oxa-2-azapentacyclo[10.3.1.03,15.06,14.08,13]hexadeca-8,10,12-trien-9-yl] (2E)-5-methylhexa-2,4-dienoate.
| Compound Name | [(1R,6R,14S,15R)-14-ethyl-2-methyl-5-oxo-7-oxa-2-azapentacyclo[10.3.1.03,15.06,14.08,13]hexadeca-8,10,12-trien-9-yl] (2E)-5-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 166897422 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [(1R,6R,14S,15R)-14-ethyl-2-methyl-5-oxo-7-oxa-2-azapentacyclo[10.3.1.03,15.06,14.08,13]hexadeca-8,10,12-trien-9-yl] (2E)-5-methylhexa-2,4-dienoate |
| SMILES | CC[C@]12c3c4ccc(OC(=O)/C=C/C=C(C)C)c3O[C@H]1C(=O)CC1[C@H]2[C@@H](C4)N1C |
| InChI | InChI=1S/C24H27NO4/c1-5-24-20-14-9-10-18(28-19(27)8-6-7-13(2)3)22(20)29-23(24)17(26)12-16-21(24)15(11-14)25(16)4/h6-10,15-16,21,23H,5,11-12H2,1-4H3/b8-6+/t15-,16?,21-,23+,24-/m1/s1 |
| InChIKey | RMAAJWVPOGIRNF-MMZMPVSOSA-N |
| XLogP | 3.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|