C26H28N2O6 — CID 69037196
[(4R,4aS,7aR,12bS)-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (PubChem CID 69037196) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
| Compound Name | [(4R,4aS,7aR,12bS)-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 69037196 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| SMILES | CN1CC[C@]23c4c5ccc(OC(=O)[C@@H](N)Cc6ccc(O)cc6)c4O[C@H]2C(=O)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C26H28N2O6/c1-28-11-10-25-21-15-4-7-19(33-24(31)17(27)12-14-2-5-16(29)6-3-14)22(21)34-23(25)18(30)8-9-26(25,32)20(28)13-15/h2-7,17,20,23,29,32H,8-13,27H2,1H3/t17-,20+,23-,25-,26+/m0/s1 |
| InChIKey | ZXYFJDUDRYRBIW-HFPFUKKDSA-N |
| XLogP | 1.22 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|