C25H32N2O4S — CID 158839651
4-[5-[(1R,9R,13R)-4-hydroxy-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]-4-oxopentyl]benzenesulfonamide (PubChem CID 158839651) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is 4-[5-[(1R,9R,13R)-4-hydroxy-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]-4-oxopentyl]benzenesulfonamide.
| Compound Name | 4-[5-[(1R,9R,13R)-4-hydroxy-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]-4-oxopentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 158839651 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 4-[5-[(1R,9R,13R)-4-hydroxy-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-1-yl]-4-oxopentyl]benzenesulfonamide |
| SMILES | C[C@H]1[C@H]2Cc3ccc(O)cc3[C@@]1(CC(=O)CCCc1ccc(S(N)(=O)=O)cc1)CCN2C |
| InChI | InChI=1S/C25H32N2O4S/c1-17-24-14-19-8-9-20(28)15-23(19)25(17,12-13-27(24)2)16-21(29)5-3-4-18-6-10-22(11-7-18)32(26,30)31/h6-11,15,17,24,28H,3-5,12-14,16H2,1-2H3,(H2,26,30,31)/t17-,24+,25+/m0/s1 |
| InChIKey | IYBPVIYRFIJKLT-XNWMQKSCSA-N |
| XLogP | 3.16 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |