C18H28N2O — CID 131985527
(1R,9R,13R)-1-[2-(dimethylamino)ethyl]-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 131985527) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is (1R,9R,13R)-1-[2-(dimethylamino)ethyl]-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,13R)-1-[2-(dimethylamino)ethyl]-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 131985527 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | (1R,9R,13R)-1-[2-(dimethylamino)ethyl]-10,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | C[C@H]1[C@H]2Cc3ccc(O)cc3[C@]1(CCN(C)C)CCN2C |
| InChI | InChI=1S/C18H28N2O/c1-13-17-11-14-5-6-15(21)12-16(14)18(13,7-9-19(2)3)8-10-20(17)4/h5-6,12-13,17,21H,7-11H2,1-4H3/t13-,17+,18+/m0/s1 |
| InChIKey | FNMDVJNGASJMHN-MORSLUCNSA-N |
| XLogP | 2.48 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |