C13H19N3O4S — CID 107074192
2-amino-5-hydroxy-N-(1-methylsulfonylpiperidin-4-yl)benzamide (PubChem CID 107074192) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-amino-5-hydroxy-N-(1-methylsulfonylpiperidin-4-yl)benzamide.
| Compound Name | 2-amino-5-hydroxy-N-(1-methylsulfonylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 107074192 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-amino-5-hydroxy-N-(1-methylsulfonylpiperidin-4-yl)benzamide |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)c2cc(O)ccc2N)CC1 |
| InChI | InChI=1S/C13H19N3O4S/c1-21(19,20)16-6-4-9(5-7-16)15-13(18)11-8-10(17)2-3-12(11)14/h2-3,8-9,17H,4-7,14H2,1H3,(H,15,18) |
| InChIKey | OZSKSMHUYLNYCM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|