C15H29N3O3S — CID 47082292
1-[4-(dimethylamino)piperidin-1-yl]-2-(1-methylsulfonylpiperidin-4-yl)ethanone (PubChem CID 47082292) has the molecular formula C15H29N3O3S and a molecular weight of 331.48 g/mol. Its IUPAC name is 1-[4-(dimethylamino)piperidin-1-yl]-2-(1-methylsulfonylpiperidin-4-yl)ethanone.
| Compound Name | 1-[4-(dimethylamino)piperidin-1-yl]-2-(1-methylsulfonylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 47082292 |
| Molecular Formula | C15H29N3O3S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-[4-(dimethylamino)piperidin-1-yl]-2-(1-methylsulfonylpiperidin-4-yl)ethanone |
| SMILES | CN(C)C1CCN(C(=O)CC2CCN(S(C)(=O)=O)CC2)CC1 |
| InChI | InChI=1S/C15H29N3O3S/c1-16(2)14-6-8-17(9-7-14)15(19)12-13-4-10-18(11-5-13)22(3,20)21/h13-14H,4-12H2,1-3H3 |
| InChIKey | KJIWZHFPRRONJN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |