C28H33N3O6S2 — CID 10984666
3-benzyl-6,9-bis-(4-methylphenyl)sulfonyl-1-oxa-3,6,9-triazacycloundecan-2-one (PubChem CID 10984666) has the molecular formula C28H33N3O6S2 and a molecular weight of 571.72 g/mol. Its IUPAC name is 3-benzyl-6,9-bis-(4-methylphenyl)sulfonyl-1-oxa-3,6,9-triazacycloundecan-2-one.
| Compound Name | 3-benzyl-6,9-bis-(4-methylphenyl)sulfonyl-1-oxa-3,6,9-triazacycloundecan-2-one |
|---|---|
| PubChem CID | 10984666 |
| Molecular Formula | C28H33N3O6S2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 3-benzyl-6,9-bis-(4-methylphenyl)sulfonyl-1-oxa-3,6,9-triazacycloundecan-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOC(=O)N(Cc3ccccc3)CCN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H33N3O6S2/c1-23-8-12-26(13-9-23)38(33,34)30-17-16-29(22-25-6-4-3-5-7-25)28(32)37-21-20-31(19-18-30)39(35,36)27-14-10-24(2)11-15-27/h3-15H,16-22H2,1-2H3 |
| InChIKey | RRCQOPHLAZTZQI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |