C26H36N3O5S2+ — CID 21146686
1-[3-methylidene-1,5-bis-(4-methylphenyl)sulfonyl-5,9-diaza-1-azoniacyclododec-1-yl]ethanone (PubChem CID 21146686) has the molecular formula C26H36N3O5S2+ and a molecular weight of 534.72 g/mol. Its IUPAC name is 1-[3-methylidene-1,5-bis-(4-methylphenyl)sulfonyl-5,9-diaza-1-azoniacyclododec-1-yl]ethanone.
| Compound Name | 1-[3-methylidene-1,5-bis-(4-methylphenyl)sulfonyl-5,9-diaza-1-azoniacyclododec-1-yl]ethanone |
|---|---|
| PubChem CID | 21146686 |
| Molecular Formula | C26H36N3O5S2+ |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 1-[3-methylidene-1,5-bis-(4-methylphenyl)sulfonyl-5,9-diaza-1-azoniacyclododec-1-yl]ethanone |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)CCCNCCC[N+](C(C)=O)(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C26H36N3O5S2/c1-21-7-11-25(12-8-21)35(31,32)28-17-5-15-27-16-6-18-29(24(4)30,20-23(3)19-28)36(33,34)26-13-9-22(2)10-14-26/h7-14,27H,3,5-6,15-20H2,1-2,4H3/q+1 |
| InChIKey | ADNUVQKLLJLIGV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|