C26H41N4O4S2+ — CID 70112849
1,1-bis-(4-methylphenyl)sulfonyl-5,9,13-triaza-1-azoniacyclohexadecane (PubChem CID 70112849) has the molecular formula C26H41N4O4S2+ and a molecular weight of 537.77 g/mol. Its IUPAC name is 1,1-bis-(4-methylphenyl)sulfonyl-5,9,13-triaza-1-azoniacyclohexadecane.
| Compound Name | 1,1-bis-(4-methylphenyl)sulfonyl-5,9,13-triaza-1-azoniacyclohexadecane |
|---|---|
| PubChem CID | 70112849 |
| Molecular Formula | C26H41N4O4S2+ |
| Molecular Weight | 537.77 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 1,1-bis-(4-methylphenyl)sulfonyl-5,9,13-triaza-1-azoniacyclohexadecane |
| SMILES | Cc1ccc(S(=O)(=O)[N+]2(S(=O)(=O)c3ccc(C)cc3)CCCNCCCNCCCNCCC2)cc1 |
| InChI | InChI=1S/C26H41N4O4S2/c1-23-7-11-25(12-8-23)35(31,32)30(36(33,34)26-13-9-24(2)10-14-26)21-5-19-28-17-3-15-27-16-4-18-29-20-6-22-30/h7-14,27-29H,3-6,15-22H2,1-2H3/q+1 |
| InChIKey | DLWBDHBIDGYXJC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|