C20H28N3O4S2+ — CID 57179240
1,1-bis-(4-methylphenyl)sulfonyl-1,4,7-triazonan-1-ium (PubChem CID 57179240) has the molecular formula C20H28N3O4S2+ and a molecular weight of 438.60 g/mol. Its IUPAC name is 1,1-bis-(4-methylphenyl)sulfonyl-1,4,7-triazonan-1-ium.
| Compound Name | 1,1-bis-(4-methylphenyl)sulfonyl-1,4,7-triazonan-1-ium |
|---|---|
| PubChem CID | 57179240 |
| Molecular Formula | C20H28N3O4S2+ |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1,1-bis-(4-methylphenyl)sulfonyl-1,4,7-triazonan-1-ium |
| SMILES | Cc1ccc(S(=O)(=O)[N+]2(S(=O)(=O)c3ccc(C)cc3)CCNCCNCC2)cc1 |
| InChI | InChI=1S/C20H28N3O4S2/c1-17-3-7-19(8-4-17)28(24,25)23(15-13-21-11-12-22-14-16-23)29(26,27)20-9-5-18(2)6-10-20/h3-10,21-22H,11-16H2,1-2H3/q+1 |
| InChIKey | ILFFIQGUBSYBOC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|