C14H20NO5S+ — CID 57028097
methyl (2S)-2-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-1-ium-1-carboxylate (PubChem CID 57028097) has the molecular formula C14H20NO5S+ and a molecular weight of 314.38 g/mol. Its IUPAC name is methyl (2S)-2-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | methyl (2S)-2-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 57028097 |
| Molecular Formula | C14H20NO5S+ |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | methyl (2S)-2-(hydroxymethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-1-ium-1-carboxylate |
| SMILES | COC(=O)[N+]1(S(=O)(=O)c2ccc(C)cc2)CCC[C@H]1CO |
| InChI | InChI=1S/C14H20NO5S/c1-11-5-7-13(8-6-11)21(18,19)15(14(17)20-2)9-3-4-12(15)10-16/h5-8,12,16H,3-4,9-10H2,1-2H3/q+1/t12-,15?/m0/s1 |
| InChIKey | VLHIIOJOXUPZSQ-SFVWDYPZSA-N |
| XLogP | 1.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|