C19H28NO7S+ — CID 57065473
1-O'-tert-butyl 1-O-methyl (1S,2R,4R)-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-1-ium-1,1-dicarboxylate (PubChem CID 57065473) has the molecular formula C19H28NO7S+ and a molecular weight of 414.50 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O-methyl (1S,2R,4R)-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-1-ium-1,1-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O-methyl (1S,2R,4R)-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-1-ium-1,1-dicarboxylate |
|---|---|
| PubChem CID | 57065473 |
| Molecular Formula | C19H28NO7S+ |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-O'-tert-butyl 1-O-methyl (1S,2R,4R)-2-methyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-1-ium-1,1-dicarboxylate |
| SMILES | COC(=O)[N@+]1(C(=O)OC(C)(C)C)C[C@H](OS(=O)(=O)c2ccc(C)cc2)C[C@H]1C |
| InChI | InChI=1S/C19H28NO7S/c1-13-7-9-16(10-8-13)28(23,24)27-15-11-14(2)20(12-15,17(21)25-6)18(22)26-19(3,4)5/h7-10,14-15H,11-12H2,1-6H3/q+1/t14-,15-,20+/m1/s1 |
| InChIKey | CXTJHVSPRVMGJQ-SXGZJXTBSA-N |
| XLogP | 3.38 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|