C20H30NO6S+ — CID 91455300
tert-butyl (2R)-2-methyl-1-[(2R)-2-(4-methylphenyl)sulfonyloxypropanoyl]pyrrolidin-1-ium-1-carboxylate (PubChem CID 91455300) has the molecular formula C20H30NO6S+ and a molecular weight of 412.53 g/mol. Its IUPAC name is tert-butyl (2R)-2-methyl-1-[(2R)-2-(4-methylphenyl)sulfonyloxypropanoyl]pyrrolidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-methyl-1-[(2R)-2-(4-methylphenyl)sulfonyloxypropanoyl]pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 91455300 |
| Molecular Formula | C20H30NO6S+ |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | tert-butyl (2R)-2-methyl-1-[(2R)-2-(4-methylphenyl)sulfonyloxypropanoyl]pyrrolidin-1-ium-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](C)C(=O)[N+]2(C(=O)OC(C)(C)C)CCC[C@H]2C)cc1 |
| InChI | InChI=1S/C20H30NO6S/c1-14-9-11-17(12-10-14)28(24,25)27-16(3)18(22)21(13-7-8-15(21)2)19(23)26-20(4,5)6/h9-12,15-16H,7-8,13H2,1-6H3/q+1/t15-,16-,21?/m1/s1 |
| InChIKey | CRBGHEMBYIRGSL-BLRYKZMTSA-N |
| XLogP | 3.55 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|