C21H32N2O6S — CID 87618278
[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-piperidin-4-ylbutyl] 4-methylbenzenesulfonate (PubChem CID 87618278) has the molecular formula C21H32N2O6S and a molecular weight of 440.56 g/mol. Its IUPAC name is [(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-piperidin-4-ylbutyl] 4-methylbenzenesulfonate.
| Compound Name | [(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-piperidin-4-ylbutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87618278 |
| Molecular Formula | C21H32N2O6S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-piperidin-4-ylbutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C(=O)[C@@H](C)NC(=O)OC(C)(C)C)C2CCNCC2)cc1 |
| InChI | InChI=1S/C21H32N2O6S/c1-14-6-8-17(9-7-14)30(26,27)29-19(16-10-12-22-13-11-16)18(24)15(2)23-20(25)28-21(3,4)5/h6-9,15-16,19,22H,10-13H2,1-5H3,(H,23,25)/t15-,19?/m1/s1 |
| InChIKey | DRFVNPBFBJUXIR-NYRJJRHWSA-N |
| XLogP | 2.55 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|