C13H20N2O3S — CID 82249735
1-(4-methoxyphenyl)sulfonyl-3-methyl-1,4-diazepane (PubChem CID 82249735) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-3-methyl-1,4-diazepane.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-3-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 82249735 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-3-methyl-1,4-diazepane |
| SMILES | COc1ccc(S(=O)(=O)N2CCCNC(C)C2)cc1 |
| InChI | InChI=1S/C13H20N2O3S/c1-11-10-15(9-3-8-14-11)19(16,17)13-6-4-12(18-2)5-7-13/h4-7,11,14H,3,8-10H2,1-2H3 |
| InChIKey | SWHFIZZFDVBKHO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |