C12H17BrN2O2S — CID 71650578
1-[3-(bromomethyl)phenyl]sulfonyl-1,4-diazepane (PubChem CID 71650578) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is 1-[3-(bromomethyl)phenyl]sulfonyl-1,4-diazepane.
| Compound Name | 1-[3-(bromomethyl)phenyl]sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 71650578 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 1-[3-(bromomethyl)phenyl]sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1cccc(CBr)c1)N1CCCNCC1 |
| InChI | InChI=1S/C12H17BrN2O2S/c13-10-11-3-1-4-12(9-11)18(16,17)15-7-2-5-14-6-8-15/h1,3-4,9,14H,2,5-8,10H2 |
| InChIKey | PMMABPZHZPUQTN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|