C17H24N4O4S — CID 119469574
4-[3-[2-(aminomethyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one (PubChem CID 119469574) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 4-[3-[2-(aminomethyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one.
| Compound Name | 4-[3-[2-(aminomethyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 119469574 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-[3-[2-(aminomethyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one |
| SMILES | NCC1CCCCN1C(=O)c1cccc(S(=O)(=O)N2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C17H24N4O4S/c18-11-14-5-1-2-8-21(14)17(23)13-4-3-6-15(10-13)26(24,25)20-9-7-19-16(22)12-20/h3-4,6,10,14H,1-2,5,7-9,11-12,18H2,(H,19,22) |
| InChIKey | NLKWZEFOMTWUJL-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |